About 2-amino-8-methyldeca-4,6-dienoic acid
2-amino-8-methyldeca-4,6-dienoic acid (PubChem CID 86256097) has the molecular formula C11H19NO2
and a molecular weight of 197.28 g/mol. Its IUPAC name is 2-amino-8-methyldeca-4,6-dienoic acid.
Molecular Properties
| Compound Name | 2-amino-8-methyldeca-4,6-dienoic acid |
| PubChem CID | 86256097 |
| Molecular Formula | C11H19NO2 |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.14 |
| IUPAC Name | 2-amino-8-methyldeca-4,6-dienoic acid |
| SMILES | CCC(C)C=CC=CCC(N)C(=O)O |
| InChI | InChI=1S/C11H19NO2/c1-3-9(2)7-5-4-6-8-10(12)11(13)14/h4-7,9-10H,3,8,12H2,1-2H3,(H,13,14) |
| InChIKey | JKGMWERDMUJXSH-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-8-methyldeca-4,6-dienoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-8-methyldeca-4,6-dienoic acid?
The IUPAC name of 2-amino-8-methyldeca-4,6-dienoic acid (CID 86256097) is 2-amino-8-methyldeca-4,6-dienoic acid.
What is the SMILES notation for 2-amino-8-methyldeca-4,6-dienoic acid?
The canonical SMILES for 2-amino-8-methyldeca-4,6-dienoic acid is CCC(C)C=CC=CCC(N)C(=O)O.
What is the InChIKey of 2-amino-8-methyldeca-4,6-dienoic acid?
The InChIKey is JKGMWERDMUJXSH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19NO2/c1-3-9(2)7-5-4-6-8-10(12)11(13)14/h4-7,9-10H,3,8,12H2,1-2H3,(H,13,14).
What are the key properties of 2-amino-8-methyldeca-4,6-dienoic acid?
2-amino-8-methyldeca-4,6-dienoic acid has a molecular weight of 197.28 g/mol, XLogP of 1.95, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-8-methyldeca-4,6-dienoic acid is sourced from PubChem (CID 86256097), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).