C14H11ClF2N2O2 — CID 86257016
2-chloro-N-[2-(2,2-difluoroethoxy)phenyl]pyridine-3-carboxamide (PubChem CID 86257016) has the molecular formula C14H11ClF2N2O2 and a molecular weight of 312.70 g/mol. Its IUPAC name is 2-chloro-N-[2-(2,2-difluoroethoxy)phenyl]pyridine-3-carboxamide.
| Compound Name | 2-chloro-N-[2-(2,2-difluoroethoxy)phenyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 86257016 |
| Molecular Formula | C14H11ClF2N2O2 |
| Molecular Weight | 312.70 g/mol |
| Exact Mass | 312.05 |
| IUPAC Name | 2-chloro-N-[2-(2,2-difluoroethoxy)phenyl]pyridine-3-carboxamide |
| SMILES | O=C(Nc1ccccc1OCC(F)F)c1cccnc1Cl |
| InChI | InChI=1S/C14H11ClF2N2O2/c15-13-9(4-3-7-18-13)14(20)19-10-5-1-2-6-11(10)21-8-12(16)17/h1-7,12H,8H2,(H,19,20) |
| InChIKey | UVALPVALSZPIOJ-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.70 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|