About 3-(3,5-dibromo-2-hydroxyphenyl)prop-2-enal
3-(3,5-dibromo-2-hydroxyphenyl)prop-2-enal (PubChem CID 86259125) has the molecular formula C9H6Br2O2
and a molecular weight of 305.95 g/mol. Its IUPAC name is 3-(3,5-dibromo-2-hydroxyphenyl)prop-2-enal.
Molecular Properties
| Compound Name | 3-(3,5-dibromo-2-hydroxyphenyl)prop-2-enal |
| PubChem CID | 86259125 |
| Molecular Formula | C9H6Br2O2 |
| Molecular Weight | 305.95 g/mol |
| Exact Mass | 303.87 |
| IUPAC Name | 3-(3,5-dibromo-2-hydroxyphenyl)prop-2-enal |
| SMILES | O=CC=Cc1cc(Br)cc(Br)c1O |
| InChI | InChI=1S/C9H6Br2O2/c10-7-4-6(2-1-3-12)9(13)8(11)5-7/h1-5,13H |
| InChIKey | CCDVJNLIEVNXJA-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.95 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 3-(3,5-dibromo-2-hydroxyphenyl)prop-2-enal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3,5-dibromo-2-hydroxyphenyl)prop-2-enal?
The IUPAC name of 3-(3,5-dibromo-2-hydroxyphenyl)prop-2-enal (CID 86259125) is 3-(3,5-dibromo-2-hydroxyphenyl)prop-2-enal.
What is the SMILES notation for 3-(3,5-dibromo-2-hydroxyphenyl)prop-2-enal?
The canonical SMILES for 3-(3,5-dibromo-2-hydroxyphenyl)prop-2-enal is O=CC=Cc1cc(Br)cc(Br)c1O.
What is the InChIKey of 3-(3,5-dibromo-2-hydroxyphenyl)prop-2-enal?
The InChIKey is CCDVJNLIEVNXJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6Br2O2/c10-7-4-6(2-1-3-12)9(13)8(11)5-7/h1-5,13H.
What are the key properties of 3-(3,5-dibromo-2-hydroxyphenyl)prop-2-enal?
3-(3,5-dibromo-2-hydroxyphenyl)prop-2-enal has a molecular weight of 305.95 g/mol, XLogP of 3.13, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,5-dibromo-2-hydroxyphenyl)prop-2-enal is sourced from PubChem (CID 86259125), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).