C14H16NP — CID 86260024
N,N-diethyl-2-phosphatricyclo[5.3.1.03,11]undeca-1(10),3,5,7(11),8-pentaen-2-amine (PubChem CID 86260024) has the molecular formula C14H16NP and a molecular weight of 229.26 g/mol. Its IUPAC name is N,N-diethyl-2-phosphatricyclo[5.3.1.03,11]undeca-1(10),3,5,7(11),8-pentaen-2-amine.
| Compound Name | N,N-diethyl-2-phosphatricyclo[5.3.1.03,11]undeca-1(10),3,5,7(11),8-pentaen-2-amine |
|---|---|
| PubChem CID | 86260024 |
| Molecular Formula | C14H16NP |
| Molecular Weight | 229.26 g/mol |
| Exact Mass | 229.10 |
| IUPAC Name | N,N-diethyl-2-phosphatricyclo[5.3.1.03,11]undeca-1(10),3,5,7(11),8-pentaen-2-amine |
| SMILES | CCN(CC)P1c2cccc3cccc1c23 |
| InChI | InChI=1S/C14H16NP/c1-3-15(4-2)16-12-9-5-7-11-8-6-10-13(16)14(11)12/h5-10H,3-4H2,1-2H3 |
| InChIKey | JWLGTYVRMSHYNC-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.26 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|