About 2-bromo-4,4-dimethylchromene
2-bromo-4,4-dimethylchromene (PubChem CID 86260183) has the molecular formula C11H11BrO
and a molecular weight of 239.11 g/mol. Its IUPAC name is 2-bromo-4,4-dimethylchromene.
Molecular Properties
| Compound Name | 2-bromo-4,4-dimethylchromene |
| PubChem CID | 86260183 |
| Molecular Formula | C11H11BrO |
| Molecular Weight | 239.11 g/mol |
| Exact Mass | 238.00 |
| IUPAC Name | 2-bromo-4,4-dimethylchromene |
| SMILES | CC1(C)C=C(Br)Oc2ccccc21 |
| InChI | InChI=1S/C11H11BrO/c1-11(2)7-10(12)13-9-6-4-3-5-8(9)11/h3-7H,1-2H3 |
| InChIKey | QGFLLPNJIKPXSV-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.11 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-bromo-4,4-dimethylchromene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-4,4-dimethylchromene?
The IUPAC name of 2-bromo-4,4-dimethylchromene (CID 86260183) is 2-bromo-4,4-dimethylchromene.
What is the SMILES notation for 2-bromo-4,4-dimethylchromene?
The canonical SMILES for 2-bromo-4,4-dimethylchromene is CC1(C)C=C(Br)Oc2ccccc21.
What is the InChIKey of 2-bromo-4,4-dimethylchromene?
The InChIKey is QGFLLPNJIKPXSV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11BrO/c1-11(2)7-10(12)13-9-6-4-3-5-8(9)11/h3-7H,1-2H3.
What are the key properties of 2-bromo-4,4-dimethylchromene?
2-bromo-4,4-dimethylchromene has a molecular weight of 239.11 g/mol, XLogP of 3.59, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-4,4-dimethylchromene is sourced from PubChem (CID 86260183), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).