About 7-chloro-3,5-dimethyloct-1-ene
7-chloro-3,5-dimethyloct-1-ene (PubChem CID 86260541) has the molecular formula C10H19Cl
and a molecular weight of 174.71 g/mol. Its IUPAC name is 7-chloro-3,5-dimethyloct-1-ene.
Molecular Properties
| Compound Name | 7-chloro-3,5-dimethyloct-1-ene |
| PubChem CID | 86260541 |
| Molecular Formula | C10H19Cl |
| Molecular Weight | 174.71 g/mol |
| Exact Mass | 174.12 |
| IUPAC Name | 7-chloro-3,5-dimethyloct-1-ene |
| SMILES | C=CC(C)CC(C)CC(C)Cl |
| InChI | InChI=1S/C10H19Cl/c1-5-8(2)6-9(3)7-10(4)11/h5,8-10H,1,6-7H2,2-4H3 |
| InChIKey | ZECJGBDYJFXNMV-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.71 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 7-chloro-3,5-dimethyloct-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-chloro-3,5-dimethyloct-1-ene?
The IUPAC name of 7-chloro-3,5-dimethyloct-1-ene (CID 86260541) is 7-chloro-3,5-dimethyloct-1-ene.
What is the SMILES notation for 7-chloro-3,5-dimethyloct-1-ene?
The canonical SMILES for 7-chloro-3,5-dimethyloct-1-ene is C=CC(C)CC(C)CC(C)Cl.
What is the InChIKey of 7-chloro-3,5-dimethyloct-1-ene?
The InChIKey is ZECJGBDYJFXNMV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19Cl/c1-5-8(2)6-9(3)7-10(4)11/h5,8-10H,1,6-7H2,2-4H3.
What are the key properties of 7-chloro-3,5-dimethyloct-1-ene?
7-chloro-3,5-dimethyloct-1-ene has a molecular weight of 174.71 g/mol, XLogP of 3.85, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 7-chloro-3,5-dimethyloct-1-ene is sourced from PubChem (CID 86260541), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).