About 3-ethyl-1,3-benzothiazol-2-imine;4-methylbenzenesulfonic acid
3-ethyl-1,3-benzothiazol-2-imine;4-methylbenzenesulfonic acid (PubChem CID 86261727) has the molecular formula C16H18N2O3S2
and a molecular weight of 350.47 g/mol. Its IUPAC name is 3-ethyl-1,3-benzothiazol-2-imine;4-methylbenzenesulfonic acid.
Molecular Properties
| Compound Name | 3-ethyl-1,3-benzothiazol-2-imine;4-methylbenzenesulfonic acid |
| PubChem CID | 86261727 |
| Molecular Formula | C16H18N2O3S2 |
| Molecular Weight | 350.47 g/mol |
| Exact Mass | 350.08 |
| IUPAC Name | 3-ethyl-1,3-benzothiazol-2-imine;4-methylbenzenesulfonic acid |
| SMILES | Cc1ccc(S(=O)(=O)O)cc1.[H]/N=c1\sc2ccccc2n1CC |
| InChI | InChI=1S/C9H10N2S.C7H8O3S/c1-2-11-7-5-3-4-6-8(7)12-9(11)10;1-6-2-4-7(5-3-6)11(8,9)10/h3-6,10H,2H2,1H3;2-5H,1H3,(H,8,9,10)/b10-9-; |
| InChIKey | JSSVVZYJFXHEIB-KVVVOXFISA-N |
| XLogP | 3.44 |
| TPSA | 83.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.47 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 3-ethyl-1,3-benzothiazol-2-imine;4-methylbenzenesulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-1,3-benzothiazol-2-imine;4-methylbenzenesulfonic acid?
The IUPAC name of 3-ethyl-1,3-benzothiazol-2-imine;4-methylbenzenesulfonic acid (CID 86261727) is 3-ethyl-1,3-benzothiazol-2-imine;4-methylbenzenesulfonic acid.
What is the SMILES notation for 3-ethyl-1,3-benzothiazol-2-imine;4-methylbenzenesulfonic acid?
The canonical SMILES for 3-ethyl-1,3-benzothiazol-2-imine;4-methylbenzenesulfonic acid is Cc1ccc(S(=O)(=O)O)cc1.[H]/N=c1\sc2ccccc2n1CC.
What is the InChIKey of 3-ethyl-1,3-benzothiazol-2-imine;4-methylbenzenesulfonic acid?
The InChIKey is JSSVVZYJFXHEIB-KVVVOXFISA-N. The full InChI is InChI=1S/C9H10N2S.C7H8O3S/c1-2-11-7-5-3-4-6-8(7)12-9(11)10;1-6-2-4-7(5-3-6)11(8,9)10/h3-6,10H,2H2,1H3;2-5H,1H3,(H,8,9,10)/b10-9-;.
What are the key properties of 3-ethyl-1,3-benzothiazol-2-imine;4-methylbenzenesulfonic acid?
3-ethyl-1,3-benzothiazol-2-imine;4-methylbenzenesulfonic acid has a molecular weight of 350.47 g/mol, XLogP of 3.44, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-1,3-benzothiazol-2-imine;4-methylbenzenesulfonic acid is sourced from PubChem (CID 86261727), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).