C16H14N6O4 — CID 86261834
N-[5-methyl-2-(4-methyl-6-oxo-1H-pyrimidin-2-yl)pyrazol-3-yl]-4-nitrobenzamide (PubChem CID 86261834) has the molecular formula C16H14N6O4 and a molecular weight of 354.33 g/mol. Its IUPAC name is N-[5-methyl-2-(4-methyl-6-oxo-1H-pyrimidin-2-yl)pyrazol-3-yl]-4-nitrobenzamide.
| Compound Name | N-[5-methyl-2-(4-methyl-6-oxo-1H-pyrimidin-2-yl)pyrazol-3-yl]-4-nitrobenzamide |
|---|---|
| PubChem CID | 86261834 |
| Molecular Formula | C16H14N6O4 |
| Molecular Weight | 354.33 g/mol |
| Exact Mass | 354.11 |
| IUPAC Name | N-[5-methyl-2-(4-methyl-6-oxo-1H-pyrimidin-2-yl)pyrazol-3-yl]-4-nitrobenzamide |
| SMILES | Cc1cc(=O)[nH]c(-n2nc(C)cc2NC(=O)c2ccc([N+](=O)[O-])cc2)n1 |
| InChI | InChI=1S/C16H14N6O4/c1-9-8-14(23)19-16(17-9)21-13(7-10(2)20-21)18-15(24)11-3-5-12(6-4-11)22(25)26/h3-8H,1-2H3,(H,18,24)(H,17,19,23) |
| InChIKey | DVSORDYVUKAQGU-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 135.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.33 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|