C15H14N6O4S — CID 86261888
2-[(5,6-dimethyl-7-oxo-8H-[1,2,4]triazolo[4,3-a]pyrimidin-3-yl)sulfanyl]-N-(4-nitrophenyl)acetamide (PubChem CID 86261888) has the molecular formula C15H14N6O4S and a molecular weight of 374.38 g/mol. Its IUPAC name is 2-[(5,6-dimethyl-7-oxo-8H-[1,2,4]triazolo[4,3-a]pyrimidin-3-yl)sulfanyl]-N-(4-nitrophenyl)acetamide.
| Compound Name | 2-[(5,6-dimethyl-7-oxo-8H-[1,2,4]triazolo[4,3-a]pyrimidin-3-yl)sulfanyl]-N-(4-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 86261888 |
| Molecular Formula | C15H14N6O4S |
| Molecular Weight | 374.38 g/mol |
| Exact Mass | 374.08 |
| IUPAC Name | 2-[(5,6-dimethyl-7-oxo-8H-[1,2,4]triazolo[4,3-a]pyrimidin-3-yl)sulfanyl]-N-(4-nitrophenyl)acetamide |
| SMILES | Cc1c(C)n2c(SCC(=O)Nc3ccc([N+](=O)[O-])cc3)nnc2[nH]c1=O |
| InChI | InChI=1S/C15H14N6O4S/c1-8-9(2)20-14(17-13(8)23)18-19-15(20)26-7-12(22)16-10-3-5-11(6-4-10)21(24)25/h3-6H,7H2,1-2H3,(H,16,22)(H,17,18,23) |
| InChIKey | TZPKAJIGBVOSKU-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 135.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.38 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|