C9H16N4O — CID 86262272
[1-(piperidin-4-ylmethyl)triazol-4-yl]methanol (PubChem CID 86262272) has the molecular formula C9H16N4O and a molecular weight of 196.25 g/mol. Its IUPAC name is [1-(piperidin-4-ylmethyl)triazol-4-yl]methanol.
| Compound Name | [1-(piperidin-4-ylmethyl)triazol-4-yl]methanol |
|---|---|
| PubChem CID | 86262272 |
| Molecular Formula | C9H16N4O |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.13 |
| IUPAC Name | [1-(piperidin-4-ylmethyl)triazol-4-yl]methanol |
| SMILES | OCc1cn(CC2CCNCC2)nn1 |
| InChI | InChI=1S/C9H16N4O/c14-7-9-6-13(12-11-9)5-8-1-3-10-4-2-8/h6,8,10,14H,1-5,7H2 |
| InChIKey | UTRKVENMMIAPFK-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 62.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |