About 3-(1-aminopropan-2-yl)-1,3-thiazolidine-2,4-dione;hydrochloride
3-(1-aminopropan-2-yl)-1,3-thiazolidine-2,4-dione;hydrochloride (PubChem CID 86262726) has the molecular formula C6H11ClN2O2S
and a molecular weight of 210.69 g/mol. Its IUPAC name is 3-(1-aminopropan-2-yl)-1,3-thiazolidine-2,4-dione;hydrochloride.
Molecular Properties
| Compound Name | 3-(1-aminopropan-2-yl)-1,3-thiazolidine-2,4-dione;hydrochloride |
| PubChem CID | 86262726 |
| Molecular Formula | C6H11ClN2O2S |
| Molecular Weight | 210.69 g/mol |
| Exact Mass | 210.02 |
| IUPAC Name | 3-(1-aminopropan-2-yl)-1,3-thiazolidine-2,4-dione;hydrochloride |
| SMILES | CC(CN)N1C(=O)CSC1=O.Cl |
| InChI | InChI=1S/C6H10N2O2S.ClH/c1-4(2-7)8-5(9)3-11-6(8)10;/h4H,2-3,7H2,1H3;1H |
| InChIKey | ZZDQQPPAKMJLFQ-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.69 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze 3-(1-aminopropan-2-yl)-1,3-thiazolidine-2,4-dione;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1-aminopropan-2-yl)-1,3-thiazolidine-2,4-dione;hydrochloride?
The IUPAC name of 3-(1-aminopropan-2-yl)-1,3-thiazolidine-2,4-dione;hydrochloride (CID 86262726) is 3-(1-aminopropan-2-yl)-1,3-thiazolidine-2,4-dione;hydrochloride.
What is the SMILES notation for 3-(1-aminopropan-2-yl)-1,3-thiazolidine-2,4-dione;hydrochloride?
The canonical SMILES for 3-(1-aminopropan-2-yl)-1,3-thiazolidine-2,4-dione;hydrochloride is CC(CN)N1C(=O)CSC1=O.Cl.
What is the InChIKey of 3-(1-aminopropan-2-yl)-1,3-thiazolidine-2,4-dione;hydrochloride?
The InChIKey is ZZDQQPPAKMJLFQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N2O2S.ClH/c1-4(2-7)8-5(9)3-11-6(8)10;/h4H,2-3,7H2,1H3;1H.
What are the key properties of 3-(1-aminopropan-2-yl)-1,3-thiazolidine-2,4-dione;hydrochloride?
3-(1-aminopropan-2-yl)-1,3-thiazolidine-2,4-dione;hydrochloride has a molecular weight of 210.69 g/mol, XLogP of 0.45, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1-aminopropan-2-yl)-1,3-thiazolidine-2,4-dione;hydrochloride is sourced from PubChem (CID 86262726), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).