C16H14N4OS — CID 86264982
[3-(4-phenyltriazol-1-yl)azetidin-1-yl]-thiophen-3-ylmethanone (PubChem CID 86264982) has the molecular formula C16H14N4OS and a molecular weight of 310.38 g/mol. Its IUPAC name is [3-(4-phenyltriazol-1-yl)azetidin-1-yl]-thiophen-3-ylmethanone.
| Compound Name | [3-(4-phenyltriazol-1-yl)azetidin-1-yl]-thiophen-3-ylmethanone |
|---|---|
| PubChem CID | 86264982 |
| Molecular Formula | C16H14N4OS |
| Molecular Weight | 310.38 g/mol |
| Exact Mass | 310.09 |
| IUPAC Name | [3-(4-phenyltriazol-1-yl)azetidin-1-yl]-thiophen-3-ylmethanone |
| SMILES | O=C(c1ccsc1)N1CC(n2cc(-c3ccccc3)nn2)C1 |
| InChI | InChI=1S/C16H14N4OS/c21-16(13-6-7-22-11-13)19-8-14(9-19)20-10-15(17-18-20)12-4-2-1-3-5-12/h1-7,10-11,14H,8-9H2 |
| InChIKey | GEWIKYJCUFCSFW-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.38 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |