C20H17FN2O3S — CID 86265376
2-[1-(5-fluoro-1-benzothiophene-2-carbonyl)azetidin-3-yl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione (PubChem CID 86265376) has the molecular formula C20H17FN2O3S and a molecular weight of 384.43 g/mol. Its IUPAC name is 2-[1-(5-fluoro-1-benzothiophene-2-carbonyl)azetidin-3-yl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione.
| Compound Name | 2-[1-(5-fluoro-1-benzothiophene-2-carbonyl)azetidin-3-yl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 86265376 |
| Molecular Formula | C20H17FN2O3S |
| Molecular Weight | 384.43 g/mol |
| Exact Mass | 384.09 |
| IUPAC Name | 2-[1-(5-fluoro-1-benzothiophene-2-carbonyl)azetidin-3-yl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
| SMILES | O=C(c1cc2cc(F)ccc2s1)N1CC(N2C(=O)C3CC=CCC3C2=O)C1 |
| InChI | InChI=1S/C20H17FN2O3S/c21-12-5-6-16-11(7-12)8-17(27-16)20(26)22-9-13(10-22)23-18(24)14-3-1-2-4-15(14)19(23)25/h1-2,5-8,13-15H,3-4,9-10H2 |
| InChIKey | PWQKRQJBFKTIAR-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.43 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|