C18H19N3O2 — CID 86266822
4-butoxy-N-pyrazolo[1,5-a]pyridin-5-ylbenzamide (PubChem CID 86266822) has the molecular formula C18H19N3O2 and a molecular weight of 309.37 g/mol. Its IUPAC name is 4-butoxy-N-pyrazolo[1,5-a]pyridin-5-ylbenzamide.
| Compound Name | 4-butoxy-N-pyrazolo[1,5-a]pyridin-5-ylbenzamide |
|---|---|
| PubChem CID | 86266822 |
| Molecular Formula | C18H19N3O2 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.15 |
| IUPAC Name | 4-butoxy-N-pyrazolo[1,5-a]pyridin-5-ylbenzamide |
| SMILES | CCCCOc1ccc(C(=O)Nc2ccn3nccc3c2)cc1 |
| InChI | InChI=1S/C18H19N3O2/c1-2-3-12-23-17-6-4-14(5-7-17)18(22)20-15-9-11-21-16(13-15)8-10-19-21/h4-11,13H,2-3,12H2,1H3,(H,20,22) |
| InChIKey | YVUFOJHRAPZZNI-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|