C20H17F3N4O3 — CID 86267507
[5-(3,5-dimethyl-1,2-oxazol-4-yl)-1H-pyrrolo[2,3-b]pyridin-3-yl]-[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]methanol (PubChem CID 86267507) has the molecular formula C20H17F3N4O3 and a molecular weight of 418.38 g/mol. Its IUPAC name is [5-(3,5-dimethyl-1,2-oxazol-4-yl)-1H-pyrrolo[2,3-b]pyridin-3-yl]-[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]methanol.
| Compound Name | [5-(3,5-dimethyl-1,2-oxazol-4-yl)-1H-pyrrolo[2,3-b]pyridin-3-yl]-[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]methanol |
|---|---|
| PubChem CID | 86267507 |
| Molecular Formula | C20H17F3N4O3 |
| Molecular Weight | 418.38 g/mol |
| Exact Mass | 418.13 |
| IUPAC Name | [5-(3,5-dimethyl-1,2-oxazol-4-yl)-1H-pyrrolo[2,3-b]pyridin-3-yl]-[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]methanol |
| SMILES | Cc1noc(C)c1-c1cnc2[nH]cc(C(O)c3ccc(OCC(F)(F)F)nc3)c2c1 |
| InChI | InChI=1S/C20H17F3N4O3/c1-10-17(11(2)30-27-10)13-5-14-15(8-26-19(14)25-7-13)18(28)12-3-4-16(24-6-12)29-9-20(21,22)23/h3-8,18,28H,9H2,1-2H3,(H,25,26) |
| InChIKey | ZIWAAFIGHOIPJD-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 97.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.38 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |