C21H24N4O4 — CID 86267771
2-[(10S)-4-(6-methoxy-1H-indol-4-yl)-8,12-dioxa-1,3,5-triazatricyclo[8.4.0.02,7]tetradeca-2,4,6-trien-6-yl]propan-2-ol (PubChem CID 86267771) has the molecular formula C21H24N4O4 and a molecular weight of 396.45 g/mol. Its IUPAC name is 2-[(10S)-4-(6-methoxy-1H-indol-4-yl)-8,12-dioxa-1,3,5-triazatricyclo[8.4.0.02,7]tetradeca-2,4,6-trien-6-yl]propan-2-ol.
| Compound Name | 2-[(10S)-4-(6-methoxy-1H-indol-4-yl)-8,12-dioxa-1,3,5-triazatricyclo[8.4.0.02,7]tetradeca-2,4,6-trien-6-yl]propan-2-ol |
|---|---|
| PubChem CID | 86267771 |
| Molecular Formula | C21H24N4O4 |
| Molecular Weight | 396.45 g/mol |
| Exact Mass | 396.18 |
| IUPAC Name | 2-[(10S)-4-(6-methoxy-1H-indol-4-yl)-8,12-dioxa-1,3,5-triazatricyclo[8.4.0.02,7]tetradeca-2,4,6-trien-6-yl]propan-2-ol |
| SMILES | COc1cc(-c2nc3c(c(C(C)(C)O)n2)OC[C@@H]2COCCN32)c2cc[nH]c2c1 |
| InChI | InChI=1S/C21H24N4O4/c1-21(2,26)18-17-20(25-6-7-28-10-12(25)11-29-17)24-19(23-18)15-8-13(27-3)9-16-14(15)4-5-22-16/h4-5,8-9,12,22,26H,6-7,10-11H2,1-3H3/t12-/m0/s1 |
| InChIKey | NKUQRYRIXLCJJV-LBPRGKRZSA-N |
| XLogP | 2.46 |
| TPSA | 92.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.45 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |