About 3-[1-(2,6-dichlorophenyl)ethoxy]-5-(1-piperidin-4-ylpyrazol-4-yl)pyridin-2-amine
3-[1-(2,6-dichlorophenyl)ethoxy]-5-(1-piperidin-4-ylpyrazol-4-yl)pyridin-2-amine (PubChem CID 86267948) has the molecular formula C21H23Cl2N5O
and a molecular weight of 432.36 g/mol. Its IUPAC name is 3-[1-(2,6-dichlorophenyl)ethoxy]-5-(1-piperidin-4-ylpyrazol-4-yl)pyridin-2-amine.
Molecular Properties
| Compound Name | 3-[1-(2,6-dichlorophenyl)ethoxy]-5-(1-piperidin-4-ylpyrazol-4-yl)pyridin-2-amine |
| PubChem CID | 86267948 |
| Molecular Formula | C21H23Cl2N5O |
| Molecular Weight | 432.36 g/mol |
| Exact Mass | 431.13 |
| IUPAC Name | 3-[1-(2,6-dichlorophenyl)ethoxy]-5-(1-piperidin-4-ylpyrazol-4-yl)pyridin-2-amine |
| SMILES | CC(Oc1cc(-c2cnn(C3CCNCC3)c2)cnc1N)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C21H23Cl2N5O/c1-13(20-17(22)3-2-4-18(20)23)29-19-9-14(10-26-21(19)24)15-11-27-28(12-15)16-5-7-25-8-6-16/h2-4,9-13,16,25H,5-8H2,1H3,(H2,24,26) |
| InChIKey | ALEALKPMZGZYBQ-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 77.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 432.36 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-[1-(2,6-dichlorophenyl)ethoxy]-5-(1-piperidin-4-ylpyrazol-4-yl)pyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[1-(2,6-dichlorophenyl)ethoxy]-5-(1-piperidin-4-ylpyrazol-4-yl)pyridin-2-amine?
The IUPAC name of 3-[1-(2,6-dichlorophenyl)ethoxy]-5-(1-piperidin-4-ylpyrazol-4-yl)pyridin-2-amine (CID 86267948) is 3-[1-(2,6-dichlorophenyl)ethoxy]-5-(1-piperidin-4-ylpyrazol-4-yl)pyridin-2-amine.
What is the SMILES notation for 3-[1-(2,6-dichlorophenyl)ethoxy]-5-(1-piperidin-4-ylpyrazol-4-yl)pyridin-2-amine?
The canonical SMILES for 3-[1-(2,6-dichlorophenyl)ethoxy]-5-(1-piperidin-4-ylpyrazol-4-yl)pyridin-2-amine is CC(Oc1cc(-c2cnn(C3CCNCC3)c2)cnc1N)c1c(Cl)cccc1Cl.
What is the InChIKey of 3-[1-(2,6-dichlorophenyl)ethoxy]-5-(1-piperidin-4-ylpyrazol-4-yl)pyridin-2-amine?
The InChIKey is ALEALKPMZGZYBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H23Cl2N5O/c1-13(20-17(22)3-2-4-18(20)23)29-19-9-14(10-26-21(19)24)15-11-27-28(12-15)16-5-7-25-8-6-16/h2-4,9-13,16,25H,5-8H2,1H3,(H2,24,26).
What are the key properties of 3-[1-(2,6-dichlorophenyl)ethoxy]-5-(1-piperidin-4-ylpyrazol-4-yl)pyridin-2-amine?
3-[1-(2,6-dichlorophenyl)ethoxy]-5-(1-piperidin-4-ylpyrazol-4-yl)pyridin-2-amine has a molecular weight of 432.36 g/mol, XLogP of 4.90, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[1-(2,6-dichlorophenyl)ethoxy]-5-(1-piperidin-4-ylpyrazol-4-yl)pyridin-2-amine is sourced from PubChem (CID 86267948), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).