C21H26N6O4S — CID 86268192
N-methyl-1-[(10S)-6-(2-methylsulfonylpropan-2-yl)-8,12-dioxa-1,3,5-triazatricyclo[8.4.0.02,7]tetradeca-2,4,6-trien-4-yl]benzimidazol-2-amine (PubChem CID 86268192) has the molecular formula C21H26N6O4S and a molecular weight of 458.54 g/mol. Its IUPAC name is N-methyl-1-[(10S)-6-(2-methylsulfonylpropan-2-yl)-8,12-dioxa-1,3,5-triazatricyclo[8.4.0.02,7]tetradeca-2,4,6-trien-4-yl]benzimidazol-2-amine.
| Compound Name | N-methyl-1-[(10S)-6-(2-methylsulfonylpropan-2-yl)-8,12-dioxa-1,3,5-triazatricyclo[8.4.0.02,7]tetradeca-2,4,6-trien-4-yl]benzimidazol-2-amine |
|---|---|
| PubChem CID | 86268192 |
| Molecular Formula | C21H26N6O4S |
| Molecular Weight | 458.54 g/mol |
| Exact Mass | 458.17 |
| IUPAC Name | N-methyl-1-[(10S)-6-(2-methylsulfonylpropan-2-yl)-8,12-dioxa-1,3,5-triazatricyclo[8.4.0.02,7]tetradeca-2,4,6-trien-4-yl]benzimidazol-2-amine |
| SMILES | CNc1nc2ccccc2n1-c1nc2c(c(C(C)(C)S(C)(=O)=O)n1)OC[C@@H]1COCCN21 |
| InChI | InChI=1S/C21H26N6O4S/c1-21(2,32(4,28)29)17-16-18(26-9-10-30-11-13(26)12-31-16)25-20(24-17)27-15-8-6-5-7-14(15)23-19(27)22-3/h5-8,13H,9-12H2,1-4H3,(H,22,23)/t13-/m0/s1 |
| InChIKey | JEWXHIMACGOZFL-ZDUSSCGKSA-N |
| XLogP | 1.73 |
| TPSA | 111.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.54 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |