About 1-ethyl-3-[[(1R,2R)-2-methylcyclohexyl]carbamothioylamino]thiourea
1-ethyl-3-[[(1R,2R)-2-methylcyclohexyl]carbamothioylamino]thiourea (PubChem CID 8626823) has the molecular formula C11H22N4S2
and a molecular weight of 274.46 g/mol. Its IUPAC name is 1-ethyl-3-[[(1R,2R)-2-methylcyclohexyl]carbamothioylamino]thiourea.
Molecular Properties
| Compound Name | 1-ethyl-3-[[(1R,2R)-2-methylcyclohexyl]carbamothioylamino]thiourea |
| PubChem CID | 8626823 |
| Molecular Formula | C11H22N4S2 |
| Molecular Weight | 274.46 g/mol |
| Exact Mass | 274.13 |
| IUPAC Name | 1-ethyl-3-[[(1R,2R)-2-methylcyclohexyl]carbamothioylamino]thiourea |
| SMILES | CCNC(=S)NNC(=S)N[C@@H]1CCCC[C@H]1C |
| InChI | InChI=1S/C11H22N4S2/c1-3-12-10(16)14-15-11(17)13-9-7-5-4-6-8(9)2/h8-9H,3-7H2,1-2H3,(H2,12,14,16)(H2,13,15,17)/t8-,9-/m1/s1 |
| InChIKey | LBHCEOJVNHGGRR-RKDXNWHRSA-N |
| XLogP | 1.43 |
| TPSA | 48.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.46 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-ethyl-3-[[(1R,2R)-2-methylcyclohexyl]carbamothioylamino]thiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-3-[[(1R,2R)-2-methylcyclohexyl]carbamothioylamino]thiourea?
The IUPAC name of 1-ethyl-3-[[(1R,2R)-2-methylcyclohexyl]carbamothioylamino]thiourea (CID 8626823) is 1-ethyl-3-[[(1R,2R)-2-methylcyclohexyl]carbamothioylamino]thiourea.
What is the SMILES notation for 1-ethyl-3-[[(1R,2R)-2-methylcyclohexyl]carbamothioylamino]thiourea?
The canonical SMILES for 1-ethyl-3-[[(1R,2R)-2-methylcyclohexyl]carbamothioylamino]thiourea is CCNC(=S)NNC(=S)N[C@@H]1CCCC[C@H]1C.
What is the InChIKey of 1-ethyl-3-[[(1R,2R)-2-methylcyclohexyl]carbamothioylamino]thiourea?
The InChIKey is LBHCEOJVNHGGRR-RKDXNWHRSA-N. The full InChI is InChI=1S/C11H22N4S2/c1-3-12-10(16)14-15-11(17)13-9-7-5-4-6-8(9)2/h8-9H,3-7H2,1-2H3,(H2,12,14,16)(H2,13,15,17)/t8-,9-/m1/s1.
What are the key properties of 1-ethyl-3-[[(1R,2R)-2-methylcyclohexyl]carbamothioylamino]thiourea?
1-ethyl-3-[[(1R,2R)-2-methylcyclohexyl]carbamothioylamino]thiourea has a molecular weight of 274.46 g/mol, XLogP of 1.43, 2 rotatable bonds, 4 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-3-[[(1R,2R)-2-methylcyclohexyl]carbamothioylamino]thiourea is sourced from PubChem (CID 8626823), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).