C23H25FN4O5S — CID 86268387
4-(5-fluoro-1H-indol-4-yl)-6-(4-methylsulfonyloxan-4-yl)-8,12-dioxa-1,3,5-triazatricyclo[8.4.0.02,7]tetradeca-2,4,6-triene (PubChem CID 86268387) has the molecular formula C23H25FN4O5S and a molecular weight of 488.54 g/mol. Its IUPAC name is 4-(5-fluoro-1H-indol-4-yl)-6-(4-methylsulfonyloxan-4-yl)-8,12-dioxa-1,3,5-triazatricyclo[8.4.0.02,7]tetradeca-2,4,6-triene.
| Compound Name | 4-(5-fluoro-1H-indol-4-yl)-6-(4-methylsulfonyloxan-4-yl)-8,12-dioxa-1,3,5-triazatricyclo[8.4.0.02,7]tetradeca-2,4,6-triene |
|---|---|
| PubChem CID | 86268387 |
| Molecular Formula | C23H25FN4O5S |
| Molecular Weight | 488.54 g/mol |
| Exact Mass | 488.15 |
| IUPAC Name | 4-(5-fluoro-1H-indol-4-yl)-6-(4-methylsulfonyloxan-4-yl)-8,12-dioxa-1,3,5-triazatricyclo[8.4.0.02,7]tetradeca-2,4,6-triene |
| SMILES | CS(=O)(=O)C1(c2nc(-c3c(F)ccc4[nH]ccc34)nc3c2OCC2COCCN32)CCOCC1 |
| InChI | InChI=1S/C23H25FN4O5S/c1-34(29,30)23(5-9-31-10-6-23)20-19-22(28-8-11-32-12-14(28)13-33-19)27-21(26-20)18-15-4-7-25-17(15)3-2-16(18)24/h2-4,7,14,25H,5-6,8-13H2,1H3 |
| InChIKey | DIJSYDFUKMEJRI-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 106.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.54 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |