C33H27ClFN7O2 — CID 86268429
N-[(1S)-1-(2-chloro-6-fluorophenyl)ethyl]-5-cyano-1-[3-[[3-(2-imidazo[1,2-b]pyridazin-3-ylethynyl)-4-methylbenzoyl]amino]propyl]pyrrole-2-carboxamide (PubChem CID 86268429) has the molecular formula C33H27ClFN7O2 and a molecular weight of 608.08 g/mol. Its IUPAC name is N-[(1S)-1-(2-chloro-6-fluorophenyl)ethyl]-5-cyano-1-[3-[[3-(2-imidazo[1,2-b]pyridazin-3-ylethynyl)-4-methylbenzoyl]amino]propyl]pyrrole-2-carboxamide.
| Compound Name | N-[(1S)-1-(2-chloro-6-fluorophenyl)ethyl]-5-cyano-1-[3-[[3-(2-imidazo[1,2-b]pyridazin-3-ylethynyl)-4-methylbenzoyl]amino]propyl]pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 86268429 |
| Molecular Formula | C33H27ClFN7O2 |
| Molecular Weight | 608.08 g/mol |
| Exact Mass | 607.19 |
| IUPAC Name | N-[(1S)-1-(2-chloro-6-fluorophenyl)ethyl]-5-cyano-1-[3-[[3-(2-imidazo[1,2-b]pyridazin-3-ylethynyl)-4-methylbenzoyl]amino]propyl]pyrrole-2-carboxamide |
| SMILES | Cc1ccc(C(=O)NCCCn2c(C#N)ccc2C(=O)N[C@@H](C)c2c(F)cccc2Cl)cc1C#Cc1cnc2cccnn12 |
| InChI | InChI=1S/C33H27ClFN7O2/c1-21-9-10-24(18-23(21)11-12-26-20-38-30-8-4-16-39-42(26)30)32(43)37-15-5-17-41-25(19-36)13-14-29(41)33(44)40-22(2)31-27(34)6-3-7-28(31)35/h3-4,6-10,13-14,16,18,20,22H,5,15,17H2,1-2H3,(H,37,43)(H,40,44)/t22-/m0/s1 |
| InChIKey | GZYKHMHMVBSLIU-QFIPXVFZSA-N |
| XLogP | 5.21 |
| TPSA | 117.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.08 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|