C28H42FNO2 — CID 86268491
(1S,3S,4R)-4-[(3aS,4R,5S,7aS)-4-[[(4-fluoro-2-methylphenyl)methylamino]methyl]-7a-methyl-1-methylidene-3,3a,4,5,6,7-hexahydro-2H-inden-5-yl]-3-(hydroxymethyl)-4-methylcyclohexan-1-ol (PubChem CID 86268491) has the molecular formula C28H42FNO2 and a molecular weight of 443.65 g/mol. Its IUPAC name is (1S,3S,4R)-4-[(3aS,4R,5S,7aS)-4-[[(4-fluoro-2-methylphenyl)methylamino]methyl]-7a-methyl-1-methylidene-3,3a,4,5,6,7-hexahydro-2H-inden-5-yl]-3-(hydroxymethyl)-4-methylcyclohexan-1-ol.
| Compound Name | (1S,3S,4R)-4-[(3aS,4R,5S,7aS)-4-[[(4-fluoro-2-methylphenyl)methylamino]methyl]-7a-methyl-1-methylidene-3,3a,4,5,6,7-hexahydro-2H-inden-5-yl]-3-(hydroxymethyl)-4-methylcyclohexan-1-ol |
|---|---|
| PubChem CID | 86268491 |
| Molecular Formula | C28H42FNO2 |
| Molecular Weight | 443.65 g/mol |
| Exact Mass | 443.32 |
| IUPAC Name | (1S,3S,4R)-4-[(3aS,4R,5S,7aS)-4-[[(4-fluoro-2-methylphenyl)methylamino]methyl]-7a-methyl-1-methylidene-3,3a,4,5,6,7-hexahydro-2H-inden-5-yl]-3-(hydroxymethyl)-4-methylcyclohexan-1-ol |
| SMILES | C=C1CC[C@H]2[C@H](CNCc3ccc(F)cc3C)[C@@H]([C@@]3(C)CC[C@H](O)C[C@@H]3CO)CC[C@]12C |
| InChI | InChI=1S/C28H42FNO2/c1-18-13-22(29)7-6-20(18)15-30-16-24-25-8-5-19(2)27(25,3)12-10-26(24)28(4)11-9-23(32)14-21(28)17-31/h6-7,13,21,23-26,30-32H,2,5,8-12,14-17H2,1,3-4H3/t21-,23+,24+,25+,26+,27-,28+/m1/s1 |
| InChIKey | TYBHPAKMPPZUDN-WVLKTHQZSA-N |
| XLogP | 5.38 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.65 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|