C21H22N4O4S — CID 86268586
4-(1H-indol-4-yl)-6-(1-methylsulfonylcyclopropyl)-8,12-dioxa-1,3,5-triazatricyclo[8.4.0.02,7]tetradeca-2,4,6-triene (PubChem CID 86268586) has the molecular formula C21H22N4O4S and a molecular weight of 426.50 g/mol. Its IUPAC name is 4-(1H-indol-4-yl)-6-(1-methylsulfonylcyclopropyl)-8,12-dioxa-1,3,5-triazatricyclo[8.4.0.02,7]tetradeca-2,4,6-triene.
| Compound Name | 4-(1H-indol-4-yl)-6-(1-methylsulfonylcyclopropyl)-8,12-dioxa-1,3,5-triazatricyclo[8.4.0.02,7]tetradeca-2,4,6-triene |
|---|---|
| PubChem CID | 86268586 |
| Molecular Formula | C21H22N4O4S |
| Molecular Weight | 426.50 g/mol |
| Exact Mass | 426.14 |
| IUPAC Name | 4-(1H-indol-4-yl)-6-(1-methylsulfonylcyclopropyl)-8,12-dioxa-1,3,5-triazatricyclo[8.4.0.02,7]tetradeca-2,4,6-triene |
| SMILES | CS(=O)(=O)C1(c2nc(-c3cccc4[nH]ccc34)nc3c2OCC2COCCN32)CC1 |
| InChI | InChI=1S/C21H22N4O4S/c1-30(26,27)21(6-7-21)18-17-20(25-9-10-28-11-13(25)12-29-17)24-19(23-18)15-3-2-4-16-14(15)5-8-22-16/h2-5,8,13,22H,6-7,9-12H2,1H3 |
| InChIKey | PMKPKMWCXGVWRU-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 97.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.50 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |