C22H24F6N4O — CID 86268750
[5-(2,2,2-trifluoroethyl)-4,6,7,8-tetrahydro-1H-pyrazolo[4,3-c]azepin-3-yl]-[4-[2-(trifluoromethyl)phenyl]piperidin-1-yl]methanone (PubChem CID 86268750) has the molecular formula C22H24F6N4O and a molecular weight of 474.45 g/mol. Its IUPAC name is [5-(2,2,2-trifluoroethyl)-4,6,7,8-tetrahydro-1H-pyrazolo[4,3-c]azepin-3-yl]-[4-[2-(trifluoromethyl)phenyl]piperidin-1-yl]methanone.
| Compound Name | [5-(2,2,2-trifluoroethyl)-4,6,7,8-tetrahydro-1H-pyrazolo[4,3-c]azepin-3-yl]-[4-[2-(trifluoromethyl)phenyl]piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 86268750 |
| Molecular Formula | C22H24F6N4O |
| Molecular Weight | 474.45 g/mol |
| Exact Mass | 474.19 |
| IUPAC Name | [5-(2,2,2-trifluoroethyl)-4,6,7,8-tetrahydro-1H-pyrazolo[4,3-c]azepin-3-yl]-[4-[2-(trifluoromethyl)phenyl]piperidin-1-yl]methanone |
| SMILES | O=C(c1n[nH]c2c1CN(CC(F)(F)F)CCC2)N1CCC(c2ccccc2C(F)(F)F)CC1 |
| InChI | InChI=1S/C22H24F6N4O/c23-21(24,25)13-31-9-3-6-18-16(12-31)19(30-29-18)20(33)32-10-7-14(8-11-32)15-4-1-2-5-17(15)22(26,27)28/h1-2,4-5,14H,3,6-13H2,(H,29,30) |
| InChIKey | SJEDNHMLOQHXDW-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 52.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.45 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |