C25H30N4O6S — CID 86269001
4-(6-methoxy-1H-indol-4-yl)-6-(4-methylsulfonyloxan-4-yl)-8,13-dioxa-1,3,5-triazatricyclo[9.4.0.02,7]pentadeca-2,4,6-triene (PubChem CID 86269001) has the molecular formula C25H30N4O6S and a molecular weight of 514.60 g/mol. Its IUPAC name is 4-(6-methoxy-1H-indol-4-yl)-6-(4-methylsulfonyloxan-4-yl)-8,13-dioxa-1,3,5-triazatricyclo[9.4.0.02,7]pentadeca-2,4,6-triene.
| Compound Name | 4-(6-methoxy-1H-indol-4-yl)-6-(4-methylsulfonyloxan-4-yl)-8,13-dioxa-1,3,5-triazatricyclo[9.4.0.02,7]pentadeca-2,4,6-triene |
|---|---|
| PubChem CID | 86269001 |
| Molecular Formula | C25H30N4O6S |
| Molecular Weight | 514.60 g/mol |
| Exact Mass | 514.19 |
| IUPAC Name | 4-(6-methoxy-1H-indol-4-yl)-6-(4-methylsulfonyloxan-4-yl)-8,13-dioxa-1,3,5-triazatricyclo[9.4.0.02,7]pentadeca-2,4,6-triene |
| SMILES | COc1cc(-c2nc3c(c(C4(S(C)(=O)=O)CCOCC4)n2)OCCC2COCCN32)c2cc[nH]c2c1 |
| InChI | InChI=1S/C25H30N4O6S/c1-32-17-13-19(18-3-7-26-20(18)14-17)23-27-22(25(36(2,30)31)5-10-33-11-6-25)21-24(28-23)29-8-12-34-15-16(29)4-9-35-21/h3,7,13-14,16,26H,4-6,8-12,15H2,1-2H3 |
| InChIKey | HABHYNQEAPJBHK-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 115.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.60 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |