C22H21F3N4O4S — CID 86269411
(10S)-6-(1-methylsulfonylcyclopropyl)-4-[6-(trifluoromethyl)-1H-indol-4-yl]-8,12-dioxa-1,3,5-triazatricyclo[8.4.0.02,7]tetradeca-2,4,6-triene (PubChem CID 86269411) has the molecular formula C22H21F3N4O4S and a molecular weight of 494.50 g/mol. Its IUPAC name is (10S)-6-(1-methylsulfonylcyclopropyl)-4-[6-(trifluoromethyl)-1H-indol-4-yl]-8,12-dioxa-1,3,5-triazatricyclo[8.4.0.02,7]tetradeca-2,4,6-triene.
| Compound Name | (10S)-6-(1-methylsulfonylcyclopropyl)-4-[6-(trifluoromethyl)-1H-indol-4-yl]-8,12-dioxa-1,3,5-triazatricyclo[8.4.0.02,7]tetradeca-2,4,6-triene |
|---|---|
| PubChem CID | 86269411 |
| Molecular Formula | C22H21F3N4O4S |
| Molecular Weight | 494.50 g/mol |
| Exact Mass | 494.12 |
| IUPAC Name | (10S)-6-(1-methylsulfonylcyclopropyl)-4-[6-(trifluoromethyl)-1H-indol-4-yl]-8,12-dioxa-1,3,5-triazatricyclo[8.4.0.02,7]tetradeca-2,4,6-triene |
| SMILES | CS(=O)(=O)C1(c2nc(-c3cc(C(F)(F)F)cc4[nH]ccc34)nc3c2OC[C@@H]2COCCN32)CC1 |
| InChI | InChI=1S/C22H21F3N4O4S/c1-34(30,31)21(3-4-21)18-17-20(29-6-7-32-10-13(29)11-33-17)28-19(27-18)15-8-12(22(23,24)25)9-16-14(15)2-5-26-16/h2,5,8-9,13,26H,3-4,6-7,10-11H2,1H3/t13-/m0/s1 |
| InChIKey | KNXYTPDSKBHCSJ-ZDUSSCGKSA-N |
| XLogP | 3.28 |
| TPSA | 97.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.50 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |