C24H25F3N4O5S — CID 86270011
(10S)-6-(4-methylsulfonyloxan-4-yl)-4-[6-(trifluoromethyl)-1H-indol-4-yl]-8,12-dioxa-1,3,5-triazatricyclo[8.4.0.02,7]tetradeca-2,4,6-triene (PubChem CID 86270011) has the molecular formula C24H25F3N4O5S and a molecular weight of 538.55 g/mol. Its IUPAC name is (10S)-6-(4-methylsulfonyloxan-4-yl)-4-[6-(trifluoromethyl)-1H-indol-4-yl]-8,12-dioxa-1,3,5-triazatricyclo[8.4.0.02,7]tetradeca-2,4,6-triene.
| Compound Name | (10S)-6-(4-methylsulfonyloxan-4-yl)-4-[6-(trifluoromethyl)-1H-indol-4-yl]-8,12-dioxa-1,3,5-triazatricyclo[8.4.0.02,7]tetradeca-2,4,6-triene |
|---|---|
| PubChem CID | 86270011 |
| Molecular Formula | C24H25F3N4O5S |
| Molecular Weight | 538.55 g/mol |
| Exact Mass | 538.15 |
| IUPAC Name | (10S)-6-(4-methylsulfonyloxan-4-yl)-4-[6-(trifluoromethyl)-1H-indol-4-yl]-8,12-dioxa-1,3,5-triazatricyclo[8.4.0.02,7]tetradeca-2,4,6-triene |
| SMILES | CS(=O)(=O)C1(c2nc(-c3cc(C(F)(F)F)cc4[nH]ccc34)nc3c2OC[C@@H]2COCCN32)CCOCC1 |
| InChI | InChI=1S/C24H25F3N4O5S/c1-37(32,33)23(3-7-34-8-4-23)20-19-22(31-6-9-35-12-15(31)13-36-19)30-21(29-20)17-10-14(24(25,26)27)11-18-16(17)2-5-28-18/h2,5,10-11,15,28H,3-4,6-9,12-13H2,1H3/t15-/m0/s1 |
| InChIKey | SFHUZUBYPOOIRT-HNNXBMFYSA-N |
| XLogP | 3.29 |
| TPSA | 106.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.55 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |