C36H31N2O2SSi+ — CID 86270113
5-[3-(2,3-dihydroindol-1-ium-1-ylidene)-7-(2,3-dihydroindol-1-yl)-5,5-dimethylbenzo[b][1]benzosilin-10-yl]thiophene-2-carboxylic acid (PubChem CID 86270113) has the molecular formula C36H31N2O2SSi+ and a molecular weight of 583.81 g/mol. Its IUPAC name is 5-[3-(2,3-dihydroindol-1-ium-1-ylidene)-7-(2,3-dihydroindol-1-yl)-5,5-dimethylbenzo[b][1]benzosilin-10-yl]thiophene-2-carboxylic acid.
| Compound Name | 5-[3-(2,3-dihydroindol-1-ium-1-ylidene)-7-(2,3-dihydroindol-1-yl)-5,5-dimethylbenzo[b][1]benzosilin-10-yl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 86270113 |
| Molecular Formula | C36H31N2O2SSi+ |
| Molecular Weight | 583.81 g/mol |
| Exact Mass | 583.19 |
| IUPAC Name | 5-[3-(2,3-dihydroindol-1-ium-1-ylidene)-7-(2,3-dihydroindol-1-yl)-5,5-dimethylbenzo[b][1]benzosilin-10-yl]thiophene-2-carboxylic acid |
| SMILES | C[Si]1(C)C2=C/C(=[N+]3/CCc4ccccc43)C=CC2=C(c2ccc(C(=O)O)s2)c2ccc(N3CCc4ccccc43)cc21 |
| InChI | InChI=1S/C36H30N2O2SSi/c1-42(2)33-21-25(37-19-17-23-7-3-5-9-29(23)37)11-13-27(33)35(31-15-16-32(41-31)36(39)40)28-14-12-26(22-34(28)42)38-20-18-24-8-4-6-10-30(24)38/h3-16,21-22H,17-20H2,1-2H3/p+1 |
| InChIKey | PRSAJFYQGILKIF-UHFFFAOYSA-O |
| XLogP | 7.25 |
| TPSA | 43.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.81 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|