C23H26N4O5S — CID 86270198
(10S)-4-(6-methoxy-1H-indol-4-yl)-6-(1-methylsulfonylcyclobutyl)-8,12-dioxa-1,3,5-triazatricyclo[8.4.0.02,7]tetradeca-2,4,6-triene (PubChem CID 86270198) has the molecular formula C23H26N4O5S and a molecular weight of 470.55 g/mol. Its IUPAC name is (10S)-4-(6-methoxy-1H-indol-4-yl)-6-(1-methylsulfonylcyclobutyl)-8,12-dioxa-1,3,5-triazatricyclo[8.4.0.02,7]tetradeca-2,4,6-triene.
| Compound Name | (10S)-4-(6-methoxy-1H-indol-4-yl)-6-(1-methylsulfonylcyclobutyl)-8,12-dioxa-1,3,5-triazatricyclo[8.4.0.02,7]tetradeca-2,4,6-triene |
|---|---|
| PubChem CID | 86270198 |
| Molecular Formula | C23H26N4O5S |
| Molecular Weight | 470.55 g/mol |
| Exact Mass | 470.16 |
| IUPAC Name | (10S)-4-(6-methoxy-1H-indol-4-yl)-6-(1-methylsulfonylcyclobutyl)-8,12-dioxa-1,3,5-triazatricyclo[8.4.0.02,7]tetradeca-2,4,6-triene |
| SMILES | COc1cc(-c2nc3c(c(C4(S(C)(=O)=O)CCC4)n2)OC[C@@H]2COCCN32)c2cc[nH]c2c1 |
| InChI | InChI=1S/C23H26N4O5S/c1-30-15-10-17(16-4-7-24-18(16)11-15)21-25-20(23(5-3-6-23)33(2,28)29)19-22(26-21)27-8-9-31-12-14(27)13-32-19/h4,7,10-11,14,24H,3,5-6,8-9,12-13H2,1-2H3/t14-/m0/s1 |
| InChIKey | LHRIYJCJTRNFGT-AWEZNQCLSA-N |
| XLogP | 2.65 |
| TPSA | 106.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.55 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |