C23H28N2O5S — CID 86270338
[(4R,7S,7aR)-9-hydroxy-11-[3-oxo-3-(2-sulfanylethylamino)propyl]-1,2,3,4,4a,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl] acetate (PubChem CID 86270338) has the molecular formula C23H28N2O5S and a molecular weight of 444.55 g/mol. Its IUPAC name is [(4R,7S,7aR)-9-hydroxy-11-[3-oxo-3-(2-sulfanylethylamino)propyl]-1,2,3,4,4a,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl] acetate.
| Compound Name | [(4R,7S,7aR)-9-hydroxy-11-[3-oxo-3-(2-sulfanylethylamino)propyl]-1,2,3,4,4a,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl] acetate |
|---|---|
| PubChem CID | 86270338 |
| Molecular Formula | C23H28N2O5S |
| Molecular Weight | 444.55 g/mol |
| Exact Mass | 444.17 |
| IUPAC Name | [(4R,7S,7aR)-9-hydroxy-11-[3-oxo-3-(2-sulfanylethylamino)propyl]-1,2,3,4,4a,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl] acetate |
| SMILES | CC(=O)O[C@H]1C=CC2[C@H]3Cc4c(CCC(=O)NCCS)cc(O)c5c4C2(CCN3)[C@H]1O5 |
| InChI | InChI=1S/C23H28N2O5S/c1-12(26)29-18-4-3-15-16-11-14-13(2-5-19(28)25-8-9-31)10-17(27)21-20(14)23(15,6-7-24-16)22(18)30-21/h3-4,10,15-16,18,22,24,27,31H,2,5-9,11H2,1H3,(H,25,28)/t15?,16-,18+,22+,23?/m1/s1 |
| InChIKey | PZJYERYXJWCHBQ-MZIMCWEXSA-N |
| XLogP | 1.41 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.55 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|