C22H24N4O5S — CID 86270383
(10S)-4-(6-methoxy-1H-indol-4-yl)-6-(1-methylsulfonylcyclopropyl)-8,12-dioxa-1,3,5-triazatricyclo[8.4.0.02,7]tetradeca-2,4,6-triene (PubChem CID 86270383) has the molecular formula C22H24N4O5S and a molecular weight of 456.52 g/mol. Its IUPAC name is (10S)-4-(6-methoxy-1H-indol-4-yl)-6-(1-methylsulfonylcyclopropyl)-8,12-dioxa-1,3,5-triazatricyclo[8.4.0.02,7]tetradeca-2,4,6-triene.
| Compound Name | (10S)-4-(6-methoxy-1H-indol-4-yl)-6-(1-methylsulfonylcyclopropyl)-8,12-dioxa-1,3,5-triazatricyclo[8.4.0.02,7]tetradeca-2,4,6-triene |
|---|---|
| PubChem CID | 86270383 |
| Molecular Formula | C22H24N4O5S |
| Molecular Weight | 456.52 g/mol |
| Exact Mass | 456.15 |
| IUPAC Name | (10S)-4-(6-methoxy-1H-indol-4-yl)-6-(1-methylsulfonylcyclopropyl)-8,12-dioxa-1,3,5-triazatricyclo[8.4.0.02,7]tetradeca-2,4,6-triene |
| SMILES | COc1cc(-c2nc3c(c(C4(S(C)(=O)=O)CC4)n2)OC[C@@H]2COCCN32)c2cc[nH]c2c1 |
| InChI | InChI=1S/C22H24N4O5S/c1-29-14-9-16(15-3-6-23-17(15)10-14)20-24-19(22(4-5-22)32(2,27)28)18-21(25-20)26-7-8-30-11-13(26)12-31-18/h3,6,9-10,13,23H,4-5,7-8,11-12H2,1-2H3/t13-/m0/s1 |
| InChIKey | CNBCCCICEJUEKE-ZDUSSCGKSA-N |
| XLogP | 2.26 |
| TPSA | 106.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.52 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |