C22H26N4O5S — CID 86270385
(10S)-4-(6-methoxy-1H-indol-4-yl)-6-(2-methylsulfonylpropan-2-yl)-8,12-dioxa-1,3,5-triazatricyclo[8.4.0.02,7]tetradeca-2,4,6-triene (PubChem CID 86270385) has the molecular formula C22H26N4O5S and a molecular weight of 458.54 g/mol. Its IUPAC name is (10S)-4-(6-methoxy-1H-indol-4-yl)-6-(2-methylsulfonylpropan-2-yl)-8,12-dioxa-1,3,5-triazatricyclo[8.4.0.02,7]tetradeca-2,4,6-triene.
| Compound Name | (10S)-4-(6-methoxy-1H-indol-4-yl)-6-(2-methylsulfonylpropan-2-yl)-8,12-dioxa-1,3,5-triazatricyclo[8.4.0.02,7]tetradeca-2,4,6-triene |
|---|---|
| PubChem CID | 86270385 |
| Molecular Formula | C22H26N4O5S |
| Molecular Weight | 458.54 g/mol |
| Exact Mass | 458.16 |
| IUPAC Name | (10S)-4-(6-methoxy-1H-indol-4-yl)-6-(2-methylsulfonylpropan-2-yl)-8,12-dioxa-1,3,5-triazatricyclo[8.4.0.02,7]tetradeca-2,4,6-triene |
| SMILES | COc1cc(-c2nc3c(c(C(C)(C)S(C)(=O)=O)n2)OC[C@@H]2COCCN32)c2cc[nH]c2c1 |
| InChI | InChI=1S/C22H26N4O5S/c1-22(2,32(4,27)28)19-18-21(26-7-8-30-11-13(26)12-31-18)25-20(24-19)16-9-14(29-3)10-17-15(16)5-6-23-17/h5-6,9-10,13,23H,7-8,11-12H2,1-4H3/t13-/m0/s1 |
| InChIKey | ZSBKVDGAHDJYQD-ZDUSSCGKSA-N |
| XLogP | 2.51 |
| TPSA | 106.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.54 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |