C32H28ClFN2O3 — CID 86270524
(E)-3-[4-[(E)-2-(2-chloro-4-fluorophenyl)-1-(2-cyano-4-morpholin-4-ylphenyl)-2-cyclobutylethenyl]phenyl]prop-2-enoic acid (PubChem CID 86270524) has the molecular formula C32H28ClFN2O3 and a molecular weight of 543.04 g/mol. Its IUPAC name is (E)-3-[4-[(E)-2-(2-chloro-4-fluorophenyl)-1-(2-cyano-4-morpholin-4-ylphenyl)-2-cyclobutylethenyl]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[(E)-2-(2-chloro-4-fluorophenyl)-1-(2-cyano-4-morpholin-4-ylphenyl)-2-cyclobutylethenyl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 86270524 |
| Molecular Formula | C32H28ClFN2O3 |
| Molecular Weight | 543.04 g/mol |
| Exact Mass | 542.18 |
| IUPAC Name | (E)-3-[4-[(E)-2-(2-chloro-4-fluorophenyl)-1-(2-cyano-4-morpholin-4-ylphenyl)-2-cyclobutylethenyl]phenyl]prop-2-enoic acid |
| SMILES | N#Cc1cc(N2CCOCC2)ccc1/C(=C(/c1ccc(F)cc1Cl)C1CCC1)c1ccc(/C=C/C(=O)O)cc1 |
| InChI | InChI=1S/C32H28ClFN2O3/c33-29-19-25(34)9-11-28(29)32(22-2-1-3-22)31(23-7-4-21(5-8-23)6-13-30(37)38)27-12-10-26(18-24(27)20-35)36-14-16-39-17-15-36/h4-13,18-19,22H,1-3,14-17H2,(H,37,38)/b13-6+,32-31+ |
| InChIKey | RKKLLXOHTCZCBU-ZOJDBYAASA-N |
| XLogP | 7.04 |
| TPSA | 73.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.04 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|