About 6-(propylamino)-3,7-dihydropurin-2-one
6-(propylamino)-3,7-dihydropurin-2-one (PubChem CID 86270675) has the molecular formula C8H11N5O
and a molecular weight of 193.21 g/mol. Its IUPAC name is 6-(propylamino)-3,7-dihydropurin-2-one.
Molecular Properties
| Compound Name | 6-(propylamino)-3,7-dihydropurin-2-one |
| PubChem CID | 86270675 |
| Molecular Formula | C8H11N5O |
| Molecular Weight | 193.21 g/mol |
| Exact Mass | 193.10 |
| IUPAC Name | 6-(propylamino)-3,7-dihydropurin-2-one |
| SMILES | CCCNc1nc(=O)[nH]c2nc[nH]c12 |
| InChI | InChI=1S/C8H11N5O/c1-2-3-9-6-5-7(11-4-10-5)13-8(14)12-6/h4H,2-3H2,1H3,(H3,9,10,11,12,13,14) |
| InChIKey | UZHKHISSFCOQQY-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.21 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-(propylamino)-3,7-dihydropurin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(propylamino)-3,7-dihydropurin-2-one?
The IUPAC name of 6-(propylamino)-3,7-dihydropurin-2-one (CID 86270675) is 6-(propylamino)-3,7-dihydropurin-2-one.
What is the SMILES notation for 6-(propylamino)-3,7-dihydropurin-2-one?
The canonical SMILES for 6-(propylamino)-3,7-dihydropurin-2-one is CCCNc1nc(=O)[nH]c2nc[nH]c12.
What is the InChIKey of 6-(propylamino)-3,7-dihydropurin-2-one?
The InChIKey is UZHKHISSFCOQQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N5O/c1-2-3-9-6-5-7(11-4-10-5)13-8(14)12-6/h4H,2-3H2,1H3,(H3,9,10,11,12,13,14).
What are the key properties of 6-(propylamino)-3,7-dihydropurin-2-one?
6-(propylamino)-3,7-dihydropurin-2-one has a molecular weight of 193.21 g/mol, XLogP of 0.47, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(propylamino)-3,7-dihydropurin-2-one is sourced from PubChem (CID 86270675), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).