C16H15N3O3S — CID 86270830
15-methyl-4-methylsulfonyl-8,12,15-triazatetracyclo[8.6.1.02,7.013,17]heptadeca-1(16),2(7),3,5,10,13(17)-hexaen-14-one (PubChem CID 86270830) has the molecular formula C16H15N3O3S and a molecular weight of 329.38 g/mol. Its IUPAC name is 15-methyl-4-methylsulfonyl-8,12,15-triazatetracyclo[8.6.1.02,7.013,17]heptadeca-1(16),2(7),3,5,10,13(17)-hexaen-14-one.
| Compound Name | 15-methyl-4-methylsulfonyl-8,12,15-triazatetracyclo[8.6.1.02,7.013,17]heptadeca-1(16),2(7),3,5,10,13(17)-hexaen-14-one |
|---|---|
| PubChem CID | 86270830 |
| Molecular Formula | C16H15N3O3S |
| Molecular Weight | 329.38 g/mol |
| Exact Mass | 329.08 |
| IUPAC Name | 15-methyl-4-methylsulfonyl-8,12,15-triazatetracyclo[8.6.1.02,7.013,17]heptadeca-1(16),2(7),3,5,10,13(17)-hexaen-14-one |
| SMILES | Cn1cc2c3c(c[nH]c3c1=O)CNc1ccc(S(C)(=O)=O)cc1-2 |
| InChI | InChI=1S/C16H15N3O3S/c1-19-8-12-11-5-10(23(2,21)22)3-4-13(11)17-6-9-7-18-15(14(9)12)16(19)20/h3-5,7-8,17-18H,6H2,1-2H3 |
| InChIKey | MGTYFUGDLHHLHE-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 83.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.38 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |