C24H27N3O5S — CID 86270836
12,15-dimethyl-4-(methylsulfonylmethyl)-8-[2-(2-oxooxolan-3-yl)ethyl]-8,12,15-triazatetracyclo[8.6.1.02,7.013,17]heptadeca-1(16),2(7),3,5,10,13(17)-hexaen-14-one (PubChem CID 86270836) has the molecular formula C24H27N3O5S and a molecular weight of 469.56 g/mol. Its IUPAC name is 12,15-dimethyl-4-(methylsulfonylmethyl)-8-[2-(2-oxooxolan-3-yl)ethyl]-8,12,15-triazatetracyclo[8.6.1.02,7.013,17]heptadeca-1(16),2(7),3,5,10,13(17)-hexaen-14-one.
| Compound Name | 12,15-dimethyl-4-(methylsulfonylmethyl)-8-[2-(2-oxooxolan-3-yl)ethyl]-8,12,15-triazatetracyclo[8.6.1.02,7.013,17]heptadeca-1(16),2(7),3,5,10,13(17)-hexaen-14-one |
|---|---|
| PubChem CID | 86270836 |
| Molecular Formula | C24H27N3O5S |
| Molecular Weight | 469.56 g/mol |
| Exact Mass | 469.17 |
| IUPAC Name | 12,15-dimethyl-4-(methylsulfonylmethyl)-8-[2-(2-oxooxolan-3-yl)ethyl]-8,12,15-triazatetracyclo[8.6.1.02,7.013,17]heptadeca-1(16),2(7),3,5,10,13(17)-hexaen-14-one |
| SMILES | Cn1cc2c3c(cn(C)c3c1=O)CN(CCC1CCOC1=O)c1ccc(CS(C)(=O)=O)cc1-2 |
| InChI | InChI=1S/C24H27N3O5S/c1-25-11-17-12-27(8-6-16-7-9-32-24(16)29)20-5-4-15(14-33(3,30)31)10-18(20)19-13-26(2)23(28)22(25)21(17)19/h4-5,10-11,13,16H,6-9,12,14H2,1-3H3 |
| InChIKey | XAJMPOAXYRKLSF-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 90.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.56 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|