C25H25N3O3S — CID 86271025
15-methyl-4-(methylsulfonylmethyl)-9-(2-phenylethyl)-8,12,15-triazatetracyclo[8.6.1.02,7.013,17]heptadeca-1(16),2(7),3,5,10,13(17)-hexaen-14-one (PubChem CID 86271025) has the molecular formula C25H25N3O3S and a molecular weight of 447.56 g/mol. Its IUPAC name is 15-methyl-4-(methylsulfonylmethyl)-9-(2-phenylethyl)-8,12,15-triazatetracyclo[8.6.1.02,7.013,17]heptadeca-1(16),2(7),3,5,10,13(17)-hexaen-14-one.
| Compound Name | 15-methyl-4-(methylsulfonylmethyl)-9-(2-phenylethyl)-8,12,15-triazatetracyclo[8.6.1.02,7.013,17]heptadeca-1(16),2(7),3,5,10,13(17)-hexaen-14-one |
|---|---|
| PubChem CID | 86271025 |
| Molecular Formula | C25H25N3O3S |
| Molecular Weight | 447.56 g/mol |
| Exact Mass | 447.16 |
| IUPAC Name | 15-methyl-4-(methylsulfonylmethyl)-9-(2-phenylethyl)-8,12,15-triazatetracyclo[8.6.1.02,7.013,17]heptadeca-1(16),2(7),3,5,10,13(17)-hexaen-14-one |
| SMILES | Cn1cc2c3c(c[nH]c3c1=O)C(CCc1ccccc1)Nc1ccc(CS(C)(=O)=O)cc1-2 |
| InChI | InChI=1S/C25H25N3O3S/c1-28-14-20-18-12-17(15-32(2,30)31)9-11-21(18)27-22(10-8-16-6-4-3-5-7-16)19-13-26-24(23(19)20)25(28)29/h3-7,9,11-14,22,26-27H,8,10,15H2,1-2H3 |
| InChIKey | QNZVSVWDJFIZOU-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 83.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.56 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |