C27H35N5O2 — CID 86271604
5-cyano-N-[2-(2,3,6,6-tetradeuterio-4,4-dimethylcyclohexen-1-yl)-6-(2,2,6,6-tetramethyloxan-4-yl)-3-pyridinyl]-1H-imidazole-2-carboxamide (PubChem CID 86271604) has the molecular formula C27H35N5O2 and a molecular weight of 465.63 g/mol. Its IUPAC name is 5-cyano-N-[2-(2,3,6,6-tetradeuterio-4,4-dimethylcyclohexen-1-yl)-6-(2,2,6,6-tetramethyloxan-4-yl)-3-pyridinyl]-1H-imidazole-2-carboxamide.
| Compound Name | 5-cyano-N-[2-(2,3,6,6-tetradeuterio-4,4-dimethylcyclohexen-1-yl)-6-(2,2,6,6-tetramethyloxan-4-yl)-3-pyridinyl]-1H-imidazole-2-carboxamide |
|---|---|
| PubChem CID | 86271604 |
| Molecular Formula | C27H35N5O2 |
| Molecular Weight | 465.63 g/mol |
| Exact Mass | 465.30 |
| IUPAC Name | 5-cyano-N-[2-(2,3,6,6-tetradeuterio-4,4-dimethylcyclohexen-1-yl)-6-(2,2,6,6-tetramethyloxan-4-yl)-3-pyridinyl]-1H-imidazole-2-carboxamide |
| SMILES | [2H]C1=C(c2nc(C3CC(C)(C)OC(C)(C)C3)ccc2NC(=O)c2ncc(C#N)[nH]2)C([2H])([2H])CC(C)(C)C1[2H] |
| InChI | InChI=1S/C27H35N5O2/c1-25(2)11-9-17(10-12-25)22-21(32-24(33)23-29-16-19(15-28)30-23)8-7-20(31-22)18-13-26(3,4)34-27(5,6)14-18/h7-9,16,18H,10-14H2,1-6H3,(H,29,30)(H,32,33)/i9D,10D2,11D |
| InChIKey | BNVPFDRNGHMRJS-RIAMFECWSA-N |
| XLogP | 5.97 |
| TPSA | 103.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.63 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |