C22H21FN2O2 — CID 86272267
trans-(1S,3R)-1-(3-fluoro-2-methylphenyl)-N-hydroxy-3-quinolin-6-ylcyclopentane-1-carboxamide (PubChem CID 86272267) has the molecular formula C22H21FN2O2 and a molecular weight of 364.42 g/mol. Its IUPAC name is trans-(1S,3R)-1-(3-fluoro-2-methylphenyl)-N-hydroxy-3-quinolin-6-ylcyclopentane-1-carboxamide.
| Compound Name | trans-(1S,3R)-1-(3-fluoro-2-methylphenyl)-N-hydroxy-3-quinolin-6-ylcyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 86272267 |
| Molecular Formula | C22H21FN2O2 |
| Molecular Weight | 364.42 g/mol |
| Exact Mass | 364.16 |
| IUPAC Name | trans-(1S,3R)-1-(3-fluoro-2-methylphenyl)-N-hydroxy-3-quinolin-6-ylcyclopentane-1-carboxamide |
| SMILES | Cc1c(F)cccc1[C@]1(C(=O)NO)CC[C@@H](c2ccc3ncccc3c2)C1 |
| InChI | InChI=1S/C22H21FN2O2/c1-14-18(5-2-6-19(14)23)22(21(26)25-27)10-9-17(13-22)15-7-8-20-16(12-15)4-3-11-24-20/h2-8,11-12,17,27H,9-10,13H2,1H3,(H,25,26)/t17-,22+/m1/s1 |
| InChIKey | TXRARWVMRQAKLP-VGSWGCGISA-N |
| XLogP | 4.39 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.42 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|