C18H18N2OS — CID 862723
6,7-dimethyl-5-phenyl-1-prop-2-enyl-3H-thieno[2,3-e][1,4]diazepin-2-one (PubChem CID 862723) has the molecular formula C18H18N2OS and a molecular weight of 310.42 g/mol. Its IUPAC name is 6,7-dimethyl-5-phenyl-1-prop-2-enyl-3H-thieno[2,3-e][1,4]diazepin-2-one.
| Compound Name | 6,7-dimethyl-5-phenyl-1-prop-2-enyl-3H-thieno[2,3-e][1,4]diazepin-2-one |
|---|---|
| PubChem CID | 862723 |
| Molecular Formula | C18H18N2OS |
| Molecular Weight | 310.42 g/mol |
| Exact Mass | 310.11 |
| IUPAC Name | 6,7-dimethyl-5-phenyl-1-prop-2-enyl-3H-thieno[2,3-e][1,4]diazepin-2-one |
| SMILES | C=CCN1C(=O)CN=C(c2ccccc2)c2c1sc(C)c2C |
| InChI | InChI=1S/C18H18N2OS/c1-4-10-20-15(21)11-19-17(14-8-6-5-7-9-14)16-12(2)13(3)22-18(16)20/h4-9H,1,10-11H2,2-3H3 |
| InChIKey | ZLUIIPHOVLCXIY-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.42 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|