C17H20FN3O6S — CID 86272498
4-[[5-(4-fluoro-3-methoxyphenyl)-1,2-oxazol-3-yl]methylamino]-N-hydroxy-1,1-dioxothiane-4-carboxamide (PubChem CID 86272498) has the molecular formula C17H20FN3O6S and a molecular weight of 413.43 g/mol. Its IUPAC name is 4-[[5-(4-fluoro-3-methoxyphenyl)-1,2-oxazol-3-yl]methylamino]-N-hydroxy-1,1-dioxothiane-4-carboxamide.
| Compound Name | 4-[[5-(4-fluoro-3-methoxyphenyl)-1,2-oxazol-3-yl]methylamino]-N-hydroxy-1,1-dioxothiane-4-carboxamide |
|---|---|
| PubChem CID | 86272498 |
| Molecular Formula | C17H20FN3O6S |
| Molecular Weight | 413.43 g/mol |
| Exact Mass | 413.11 |
| IUPAC Name | 4-[[5-(4-fluoro-3-methoxyphenyl)-1,2-oxazol-3-yl]methylamino]-N-hydroxy-1,1-dioxothiane-4-carboxamide |
| SMILES | COc1cc(-c2cc(CNC3(C(=O)NO)CCS(=O)(=O)CC3)no2)ccc1F |
| InChI | InChI=1S/C17H20FN3O6S/c1-26-15-8-11(2-3-13(15)18)14-9-12(21-27-14)10-19-17(16(22)20-23)4-6-28(24,25)7-5-17/h2-3,8-9,19,23H,4-7,10H2,1H3,(H,20,22) |
| InChIKey | CMBNKKTVJHVZDE-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 130.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.43 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|