C41H33N7Pt+2 — CID 86272504
1-benzyl-4-(4-tritylphenyl)triazole;platinum(2+);2-(1H-1,2,4-triazol-5-yl)pyridine (PubChem CID 86272504) has the molecular formula C41H33N7Pt+2 and a molecular weight of 818.84 g/mol. Its IUPAC name is 1-benzyl-4-(4-tritylphenyl)triazole;platinum(2+);2-(1H-1,2,4-triazol-5-yl)pyridine.
| Compound Name | 1-benzyl-4-(4-tritylphenyl)triazole;platinum(2+);2-(1H-1,2,4-triazol-5-yl)pyridine |
|---|---|
| PubChem CID | 86272504 |
| Molecular Formula | C41H33N7Pt+2 |
| Molecular Weight | 818.84 g/mol |
| Exact Mass | 818.24 |
| IUPAC Name | 1-benzyl-4-(4-tritylphenyl)triazole;platinum(2+);2-(1H-1,2,4-triazol-5-yl)pyridine |
| SMILES | [Pt+2].c1ccc(-c2ncn[nH]2)nc1.c1ccc(Cn2cc(-c3ccc(C(c4ccccc4)(c4ccccc4)c4ccccc4)cc3)nn2)cc1 |
| InChI | InChI=1S/C34H27N3.C7H6N4.Pt/c1-5-13-27(14-6-1)25-37-26-33(35-36-37)28-21-23-32(24-22-28)34(29-15-7-2-8-16-29,30-17-9-3-10-18-30)31-19-11-4-12-20-31;1-2-4-8-6(3-1)7-9-5-10-11-7;/h1-24,26H,25H2;1-5H,(H,9,10,11);/q;;+2 |
| InChIKey | YCPOKCGCJURICA-UHFFFAOYSA-N |
| XLogP | 8.24 |
| TPSA | 85.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 818.84 |
| LogP ≤ 5 | 8.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|