C26H26N4O — CID 86272645
2-amino-3-cyclohexyl-5-phenyl-5-(3-pyridin-4-ylphenyl)imidazol-4-one (PubChem CID 86272645) has the molecular formula C26H26N4O and a molecular weight of 410.52 g/mol. Its IUPAC name is 2-amino-3-cyclohexyl-5-phenyl-5-(3-pyridin-4-ylphenyl)imidazol-4-one.
| Compound Name | 2-amino-3-cyclohexyl-5-phenyl-5-(3-pyridin-4-ylphenyl)imidazol-4-one |
|---|---|
| PubChem CID | 86272645 |
| Molecular Formula | C26H26N4O |
| Molecular Weight | 410.52 g/mol |
| Exact Mass | 410.21 |
| IUPAC Name | 2-amino-3-cyclohexyl-5-phenyl-5-(3-pyridin-4-ylphenyl)imidazol-4-one |
| SMILES | NC1=NC(c2ccccc2)(c2cccc(-c3ccncc3)c2)C(=O)N1C1CCCCC1 |
| InChI | InChI=1S/C26H26N4O/c27-25-29-26(21-9-3-1-4-10-21,24(31)30(25)23-12-5-2-6-13-23)22-11-7-8-20(18-22)19-14-16-28-17-15-19/h1,3-4,7-11,14-18,23H,2,5-6,12-13H2,(H2,27,29) |
| InChIKey | PELJWIRYZWWWKO-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 71.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.52 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |