About 5-[2-[4-(2,4-dimethylphenyl)piperazin-1-yl]ethyl]-3,3-diethyloxolan-2-one
5-[2-[4-(2,4-dimethylphenyl)piperazin-1-yl]ethyl]-3,3-diethyloxolan-2-one (PubChem CID 86273133) has the molecular formula C22H34N2O2
and a molecular weight of 358.53 g/mol. Its IUPAC name is 5-[2-[4-(2,4-dimethylphenyl)piperazin-1-yl]ethyl]-3,3-diethyloxolan-2-one.
Molecular Properties
| Compound Name | 5-[2-[4-(2,4-dimethylphenyl)piperazin-1-yl]ethyl]-3,3-diethyloxolan-2-one |
| PubChem CID | 86273133 |
| Molecular Formula | C22H34N2O2 |
| Molecular Weight | 358.53 g/mol |
| Exact Mass | 358.26 |
| IUPAC Name | 5-[2-[4-(2,4-dimethylphenyl)piperazin-1-yl]ethyl]-3,3-diethyloxolan-2-one |
| SMILES | CCC1(CC)CC(CCN2CCN(c3ccc(C)cc3C)CC2)OC1=O |
| InChI | InChI=1S/C22H34N2O2/c1-5-22(6-2)16-19(26-21(22)25)9-10-23-11-13-24(14-12-23)20-8-7-17(3)15-18(20)4/h7-8,15,19H,5-6,9-14,16H2,1-4H3 |
| InChIKey | FKXIFAHTTDOAHZ-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.53 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-[2-[4-(2,4-dimethylphenyl)piperazin-1-yl]ethyl]-3,3-diethyloxolan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[2-[4-(2,4-dimethylphenyl)piperazin-1-yl]ethyl]-3,3-diethyloxolan-2-one?
The IUPAC name of 5-[2-[4-(2,4-dimethylphenyl)piperazin-1-yl]ethyl]-3,3-diethyloxolan-2-one (CID 86273133) is 5-[2-[4-(2,4-dimethylphenyl)piperazin-1-yl]ethyl]-3,3-diethyloxolan-2-one.
What is the SMILES notation for 5-[2-[4-(2,4-dimethylphenyl)piperazin-1-yl]ethyl]-3,3-diethyloxolan-2-one?
The canonical SMILES for 5-[2-[4-(2,4-dimethylphenyl)piperazin-1-yl]ethyl]-3,3-diethyloxolan-2-one is CCC1(CC)CC(CCN2CCN(c3ccc(C)cc3C)CC2)OC1=O.
What is the InChIKey of 5-[2-[4-(2,4-dimethylphenyl)piperazin-1-yl]ethyl]-3,3-diethyloxolan-2-one?
The InChIKey is FKXIFAHTTDOAHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H34N2O2/c1-5-22(6-2)16-19(26-21(22)25)9-10-23-11-13-24(14-12-23)20-8-7-17(3)15-18(20)4/h7-8,15,19H,5-6,9-14,16H2,1-4H3.
What are the key properties of 5-[2-[4-(2,4-dimethylphenyl)piperazin-1-yl]ethyl]-3,3-diethyloxolan-2-one?
5-[2-[4-(2,4-dimethylphenyl)piperazin-1-yl]ethyl]-3,3-diethyloxolan-2-one has a molecular weight of 358.53 g/mol, XLogP of 3.94, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[2-[4-(2,4-dimethylphenyl)piperazin-1-yl]ethyl]-3,3-diethyloxolan-2-one is sourced from PubChem (CID 86273133), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).