C16H13FN2O2 — CID 86273565
10-(3-fluoropropyl)-3-oxa-10,15-diazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2(6),7,11(16),12,14-hexaen-5-one (PubChem CID 86273565) has the molecular formula C16H13FN2O2 and a molecular weight of 284.29 g/mol. Its IUPAC name is 10-(3-fluoropropyl)-3-oxa-10,15-diazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2(6),7,11(16),12,14-hexaen-5-one.
| Compound Name | 10-(3-fluoropropyl)-3-oxa-10,15-diazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2(6),7,11(16),12,14-hexaen-5-one |
|---|---|
| PubChem CID | 86273565 |
| Molecular Formula | C16H13FN2O2 |
| Molecular Weight | 284.29 g/mol |
| Exact Mass | 284.10 |
| IUPAC Name | 10-(3-fluoropropyl)-3-oxa-10,15-diazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2(6),7,11(16),12,14-hexaen-5-one |
| SMILES | O=C1COc2c1ccc1c2c2ncccc2n1CCCF |
| InChI | InChI=1S/C16H13FN2O2/c17-6-2-8-19-11-5-4-10-13(20)9-21-16(10)14(11)15-12(19)3-1-7-18-15/h1,3-5,7H,2,6,8-9H2 |
| InChIKey | AAYYBABEIRARKT-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.29 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |