C20H22F4N2O2 — CID 86273622
2-fluoro-6-[[2-[2-(3,3,3-trifluoropropyl)pyrazol-3-yl]cyclohexyl]methoxy]benzaldehyde (PubChem CID 86273622) has the molecular formula C20H22F4N2O2 and a molecular weight of 398.40 g/mol. Its IUPAC name is 2-fluoro-6-[[2-[2-(3,3,3-trifluoropropyl)pyrazol-3-yl]cyclohexyl]methoxy]benzaldehyde.
| Compound Name | 2-fluoro-6-[[2-[2-(3,3,3-trifluoropropyl)pyrazol-3-yl]cyclohexyl]methoxy]benzaldehyde |
|---|---|
| PubChem CID | 86273622 |
| Molecular Formula | C20H22F4N2O2 |
| Molecular Weight | 398.40 g/mol |
| Exact Mass | 398.16 |
| IUPAC Name | 2-fluoro-6-[[2-[2-(3,3,3-trifluoropropyl)pyrazol-3-yl]cyclohexyl]methoxy]benzaldehyde |
| SMILES | O=Cc1c(F)cccc1OCC1CCCCC1c1ccnn1CCC(F)(F)F |
| InChI | InChI=1S/C20H22F4N2O2/c21-17-6-3-7-19(16(17)12-27)28-13-14-4-1-2-5-15(14)18-8-10-25-26(18)11-9-20(22,23)24/h3,6-8,10,12,14-15H,1-2,4-5,9,11,13H2 |
| InChIKey | CBOJXNYTPGXTNN-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.40 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|