C24H36ClNO2 — CID 86273710
(1S,3S,4R)-4-[(3aR,4S,5S,7aS)-4-(aminomethyl)-1-phenyl-3a,4,5,6,7,7a-hexahydro-3H-inden-5-yl]-3-(hydroxymethyl)-4-methylcyclohexan-1-ol;hydrochloride (PubChem CID 86273710) has the molecular formula C24H36ClNO2 and a molecular weight of 406.01 g/mol. Its IUPAC name is (1S,3S,4R)-4-[(3aR,4S,5S,7aS)-4-(aminomethyl)-1-phenyl-3a,4,5,6,7,7a-hexahydro-3H-inden-5-yl]-3-(hydroxymethyl)-4-methylcyclohexan-1-ol;hydrochloride.
| Compound Name | (1S,3S,4R)-4-[(3aR,4S,5S,7aS)-4-(aminomethyl)-1-phenyl-3a,4,5,6,7,7a-hexahydro-3H-inden-5-yl]-3-(hydroxymethyl)-4-methylcyclohexan-1-ol;hydrochloride |
|---|---|
| PubChem CID | 86273710 |
| Molecular Formula | C24H36ClNO2 |
| Molecular Weight | 406.01 g/mol |
| Exact Mass | 405.24 |
| IUPAC Name | (1S,3S,4R)-4-[(3aR,4S,5S,7aS)-4-(aminomethyl)-1-phenyl-3a,4,5,6,7,7a-hexahydro-3H-inden-5-yl]-3-(hydroxymethyl)-4-methylcyclohexan-1-ol;hydrochloride |
| SMILES | C[C@]1([C@H]2CC[C@@H]3C(c4ccccc4)=CC[C@H]3[C@@H]2CN)CC[C@H](O)C[C@@H]1CO.Cl |
| InChI | InChI=1S/C24H35NO2.ClH/c1-24(12-11-18(27)13-17(24)15-26)23-10-9-20-19(16-5-3-2-4-6-16)7-8-21(20)22(23)14-25;/h2-7,17-18,20-23,26-27H,8-15,25H2,1H3;1H/t17-,18+,20-,21-,22+,23+,24+;/m1./s1 |
| InChIKey | AOWUGZNKWIUBDD-CKJOMDJPSA-N |
| XLogP | 4.27 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.01 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |