About 4-[4-[2-(4,4-diethyl-5-oxooxolan-2-yl)ethyl]piperazin-1-yl]benzonitrile
4-[4-[2-(4,4-diethyl-5-oxooxolan-2-yl)ethyl]piperazin-1-yl]benzonitrile (PubChem CID 86273860) has the molecular formula C21H29N3O2
and a molecular weight of 355.48 g/mol. Its IUPAC name is 4-[4-[2-(4,4-diethyl-5-oxooxolan-2-yl)ethyl]piperazin-1-yl]benzonitrile.
Molecular Properties
| Compound Name | 4-[4-[2-(4,4-diethyl-5-oxooxolan-2-yl)ethyl]piperazin-1-yl]benzonitrile |
| PubChem CID | 86273860 |
| Molecular Formula | C21H29N3O2 |
| Molecular Weight | 355.48 g/mol |
| Exact Mass | 355.23 |
| IUPAC Name | 4-[4-[2-(4,4-diethyl-5-oxooxolan-2-yl)ethyl]piperazin-1-yl]benzonitrile |
| SMILES | CCC1(CC)CC(CCN2CCN(c3ccc(C#N)cc3)CC2)OC1=O |
| InChI | InChI=1S/C21H29N3O2/c1-3-21(4-2)15-19(26-20(21)25)9-10-23-11-13-24(14-12-23)18-7-5-17(16-22)6-8-18/h5-8,19H,3-4,9-15H2,1-2H3 |
| InChIKey | VHRFRSHCJJLTNW-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 56.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.48 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[4-[2-(4,4-diethyl-5-oxooxolan-2-yl)ethyl]piperazin-1-yl]benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-[2-(4,4-diethyl-5-oxooxolan-2-yl)ethyl]piperazin-1-yl]benzonitrile?
The IUPAC name of 4-[4-[2-(4,4-diethyl-5-oxooxolan-2-yl)ethyl]piperazin-1-yl]benzonitrile (CID 86273860) is 4-[4-[2-(4,4-diethyl-5-oxooxolan-2-yl)ethyl]piperazin-1-yl]benzonitrile.
What is the SMILES notation for 4-[4-[2-(4,4-diethyl-5-oxooxolan-2-yl)ethyl]piperazin-1-yl]benzonitrile?
The canonical SMILES for 4-[4-[2-(4,4-diethyl-5-oxooxolan-2-yl)ethyl]piperazin-1-yl]benzonitrile is CCC1(CC)CC(CCN2CCN(c3ccc(C#N)cc3)CC2)OC1=O.
What is the InChIKey of 4-[4-[2-(4,4-diethyl-5-oxooxolan-2-yl)ethyl]piperazin-1-yl]benzonitrile?
The InChIKey is VHRFRSHCJJLTNW-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H29N3O2/c1-3-21(4-2)15-19(26-20(21)25)9-10-23-11-13-24(14-12-23)18-7-5-17(16-22)6-8-18/h5-8,19H,3-4,9-15H2,1-2H3.
What are the key properties of 4-[4-[2-(4,4-diethyl-5-oxooxolan-2-yl)ethyl]piperazin-1-yl]benzonitrile?
4-[4-[2-(4,4-diethyl-5-oxooxolan-2-yl)ethyl]piperazin-1-yl]benzonitrile has a molecular weight of 355.48 g/mol, XLogP of 3.19, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-[2-(4,4-diethyl-5-oxooxolan-2-yl)ethyl]piperazin-1-yl]benzonitrile is sourced from PubChem (CID 86273860), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).