C17H11F6N5OS — CID 86274839
[(8R)-8-methyl-3-[2-(trifluoromethyl)-1,3-thiazol-4-yl]-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]-(2,3,4-trifluorophenyl)methanone (PubChem CID 86274839) has the molecular formula C17H11F6N5OS and a molecular weight of 447.36 g/mol. Its IUPAC name is [(8R)-8-methyl-3-[2-(trifluoromethyl)-1,3-thiazol-4-yl]-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]-(2,3,4-trifluorophenyl)methanone.
| Compound Name | [(8R)-8-methyl-3-[2-(trifluoromethyl)-1,3-thiazol-4-yl]-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]-(2,3,4-trifluorophenyl)methanone |
|---|---|
| PubChem CID | 86274839 |
| Molecular Formula | C17H11F6N5OS |
| Molecular Weight | 447.36 g/mol |
| Exact Mass | 447.06 |
| IUPAC Name | [(8R)-8-methyl-3-[2-(trifluoromethyl)-1,3-thiazol-4-yl]-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]-(2,3,4-trifluorophenyl)methanone |
| SMILES | C[C@@H]1c2nnc(-c3csc(C(F)(F)F)n3)n2CCN1C(=O)c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C17H11F6N5OS/c1-7-13-25-26-14(10-6-30-16(24-10)17(21,22)23)28(13)5-4-27(7)15(29)8-2-3-9(18)12(20)11(8)19/h2-3,6-7H,4-5H2,1H3/t7-/m1/s1 |
| InChIKey | UISHJVFGYAWGBZ-SSDOTTSWSA-N |
| XLogP | 4.05 |
| TPSA | 63.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.36 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|