C17H17FN6O2S — CID 86275212
(4-fluoro-3-methoxyphenyl)-[(8R)-8-methyl-3-(3-methyl-1,2,4-thiadiazol-5-yl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]methanone (PubChem CID 86275212) has the molecular formula C17H17FN6O2S and a molecular weight of 388.43 g/mol. Its IUPAC name is (4-fluoro-3-methoxyphenyl)-[(8R)-8-methyl-3-(3-methyl-1,2,4-thiadiazol-5-yl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]methanone.
| Compound Name | (4-fluoro-3-methoxyphenyl)-[(8R)-8-methyl-3-(3-methyl-1,2,4-thiadiazol-5-yl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]methanone |
|---|---|
| PubChem CID | 86275212 |
| Molecular Formula | C17H17FN6O2S |
| Molecular Weight | 388.43 g/mol |
| Exact Mass | 388.11 |
| IUPAC Name | (4-fluoro-3-methoxyphenyl)-[(8R)-8-methyl-3-(3-methyl-1,2,4-thiadiazol-5-yl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]methanone |
| SMILES | COc1cc(C(=O)N2CCn3c(-c4nc(C)ns4)nnc3[C@H]2C)ccc1F |
| InChI | InChI=1S/C17H17FN6O2S/c1-9-14-20-21-15(16-19-10(2)22-27-16)24(14)7-6-23(9)17(25)11-4-5-12(18)13(8-11)26-3/h4-5,8-9H,6-7H2,1-3H3/t9-/m1/s1 |
| InChIKey | DQMSMVVVIQFBKB-SECBINFHSA-N |
| XLogP | 2.47 |
| TPSA | 86.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.43 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |